C18H20ClFN4 — CID 141041674
7-[3-(aminomethyl)phenyl]-8-chloro-1-cyclopropyl-6-fluoro-2,4-dihydroquinazolin-3-amine (PubChem CID 141041674) has the molecular formula C18H20ClFN4 and a molecular weight of 346.84 g/mol. Its IUPAC name is 7-[3-(aminomethyl)phenyl]-8-chloro-1-cyclopropyl-6-fluoro-2,4-dihydroquinazolin-3-amine.
| Compound Name | 7-[3-(aminomethyl)phenyl]-8-chloro-1-cyclopropyl-6-fluoro-2,4-dihydroquinazolin-3-amine |
|---|---|
| PubChem CID | 141041674 |
| Molecular Formula | C18H20ClFN4 |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 7-[3-(aminomethyl)phenyl]-8-chloro-1-cyclopropyl-6-fluoro-2,4-dihydroquinazolin-3-amine |
| SMILES | NCc1cccc(-c2c(F)cc3c(c2Cl)N(C2CC2)CN(N)C3)c1 |
| InChI | InChI=1S/C18H20ClFN4/c19-17-16(12-3-1-2-11(6-12)8-21)15(20)7-13-9-23(22)10-24(18(13)17)14-4-5-14/h1-3,6-7,14H,4-5,8-10,21-22H2 |
| InChIKey | IRTPAQLWMVNTRH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|