C17H26FN5O — CID 139960231
7-[(3S,4R)-3-amino-4-methylpyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-8-methoxy-2,4-dihydroquinazolin-3-amine (PubChem CID 139960231) has the molecular formula C17H26FN5O and a molecular weight of 335.43 g/mol. Its IUPAC name is 7-[(3S,4R)-3-amino-4-methylpyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-8-methoxy-2,4-dihydroquinazolin-3-amine.
| Compound Name | 7-[(3S,4R)-3-amino-4-methylpyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-8-methoxy-2,4-dihydroquinazolin-3-amine |
|---|---|
| PubChem CID | 139960231 |
| Molecular Formula | C17H26FN5O |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 7-[(3S,4R)-3-amino-4-methylpyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-8-methoxy-2,4-dihydroquinazolin-3-amine |
| SMILES | COc1c(N2C[C@@H](C)[C@H](N)C2)c(F)cc2c1N(C1CC1)CN(N)C2 |
| InChI | InChI=1S/C17H26FN5O/c1-10-6-21(8-14(10)19)16-13(18)5-11-7-22(20)9-23(12-3-4-12)15(11)17(16)24-2/h5,10,12,14H,3-4,6-9,19-20H2,1-2H3/t10-,14-/m1/s1 |
| InChIKey | QHWWTFJIMAYSQU-QMTHXVAHSA-N |
| XLogP | 1.23 |
| TPSA | 70.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|