C13H8F3NO4 — CID 67847462
1-cyclopropyl-6,7,8-trifluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid (PubChem CID 67847462) has the molecular formula C13H8F3NO4 and a molecular weight of 299.20 g/mol. Its IUPAC name is 1-cyclopropyl-6,7,8-trifluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid.
| Compound Name | 1-cyclopropyl-6,7,8-trifluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 67847462 |
| Molecular Formula | C13H8F3NO4 |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 1-cyclopropyl-6,7,8-trifluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid |
| SMILES | O=C1C(=O)C(C(=O)O)N(C2CC2)c2c1cc(F)c(F)c2F |
| InChI | InChI=1S/C13H8F3NO4/c14-6-3-5-9(8(16)7(6)15)17(4-1-2-4)10(13(20)21)12(19)11(5)18/h3-4,10H,1-2H2,(H,20,21) |
| InChIKey | UYTJTIAPHAHYLW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|