C18H18F3NO3 — CID 175230605
ethyl 1,3-dicyclopropyl-6,7,8-trifluoro-4-oxo-2H-quinoline-3-carboxylate (PubChem CID 175230605) has the molecular formula C18H18F3NO3 and a molecular weight of 353.34 g/mol. Its IUPAC name is ethyl 1,3-dicyclopropyl-6,7,8-trifluoro-4-oxo-2H-quinoline-3-carboxylate.
| Compound Name | ethyl 1,3-dicyclopropyl-6,7,8-trifluoro-4-oxo-2H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 175230605 |
| Molecular Formula | C18H18F3NO3 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | ethyl 1,3-dicyclopropyl-6,7,8-trifluoro-4-oxo-2H-quinoline-3-carboxylate |
| SMILES | CCOC(=O)C1(C2CC2)CN(C2CC2)c2c(cc(F)c(F)c2F)C1=O |
| InChI | InChI=1S/C18H18F3NO3/c1-2-25-17(24)18(9-3-4-9)8-22(10-5-6-10)15-11(16(18)23)7-12(19)13(20)14(15)21/h7,9-10H,2-6,8H2,1H3 |
| InChIKey | VGPJFWVZYUKWKK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|