C10H5F2NO4 — CID 141040716
1,5-difluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid (PubChem CID 141040716) has the molecular formula C10H5F2NO4 and a molecular weight of 241.15 g/mol. Its IUPAC name is 1,5-difluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid.
| Compound Name | 1,5-difluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 141040716 |
| Molecular Formula | C10H5F2NO4 |
| Molecular Weight | 241.15 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | 1,5-difluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid |
| SMILES | O=C1C(=O)C(C(=O)O)N(F)c2cccc(F)c21 |
| InChI | InChI=1S/C10H5F2NO4/c11-4-2-1-3-5-6(4)8(14)9(15)7(10(16)17)13(5)12/h1-3,7H,(H,16,17) |
| InChIKey | HRLZLHWOYNFSGF-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.15 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|