1,5-difluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid

C10H5F2NO4 — CID 141040716

IUPAC1,5-difluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid
SMILESO=C1C(=O)C(C(=O)O)N(F)c2cccc(F)c21
InChIInChI=1S/C10H5F2NO4/c11-4-2-1-3-5-6(4)8(14)9(15)7(10(16)17)13(5)12/h1-3,7H,(H,16,17)
InChIKeyHRLZLHWOYNFSGF-UHFFFAOYSA-N
MW241.15 g/mol
LogP0.74
Rot. Bonds1

About 1,5-difluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid

1,5-difluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid (PubChem CID 141040716) has the molecular formula C10H5F2NO4 and a molecular weight of 241.15 g/mol. Its IUPAC name is 1,5-difluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid.

Molecular Properties

Compound Name1,5-difluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid
PubChem CID141040716
Molecular FormulaC10H5F2NO4
Molecular Weight241.15 g/mol
Exact Mass241.02
IUPAC Name1,5-difluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid
SMILESO=C1C(=O)C(C(=O)O)N(F)c2cccc(F)c21
InChIInChI=1S/C10H5F2NO4/c11-4-2-1-3-5-6(4)8(14)9(15)7(10(16)17)13(5)12/h1-3,7H,(H,16,17)
InChIKeyHRLZLHWOYNFSGF-UHFFFAOYSA-N
XLogP0.74
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.15
LogP ≤ 50.74
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}

Analyze 1,5-difluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,5-difluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid?
The IUPAC name of 1,5-difluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid (CID 141040716) is 1,5-difluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid.
What is the SMILES notation for 1,5-difluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid?
The canonical SMILES for 1,5-difluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid is O=C1C(=O)C(C(=O)O)N(F)c2cccc(F)c21.
What is the InChIKey of 1,5-difluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid?
The InChIKey is HRLZLHWOYNFSGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5F2NO4/c11-4-2-1-3-5-6(4)8(14)9(15)7(10(16)17)13(5)12/h1-3,7H,(H,16,17).
What are the key properties of 1,5-difluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid?
1,5-difluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid has a molecular weight of 241.15 g/mol, XLogP of 0.74, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-difluoro-3,4-dioxo-2H-quinoline-2-carboxylic acid is sourced from PubChem (CID 141040716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).