C16H11F2N3O4 — CID 19903250
1-cyclopropyl-6,8-difluoro-7-imidazol-1-yl-2,4-dioxoquinoline-3-carboxylic acid (PubChem CID 19903250) has the molecular formula C16H11F2N3O4 and a molecular weight of 347.28 g/mol. Its IUPAC name is 1-cyclopropyl-6,8-difluoro-7-imidazol-1-yl-2,4-dioxoquinoline-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-6,8-difluoro-7-imidazol-1-yl-2,4-dioxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 19903250 |
| Molecular Formula | C16H11F2N3O4 |
| Molecular Weight | 347.28 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 1-cyclopropyl-6,8-difluoro-7-imidazol-1-yl-2,4-dioxoquinoline-3-carboxylic acid |
| SMILES | O=C(O)C1C(=O)c2cc(F)c(-n3ccnc3)c(F)c2N(C2CC2)C1=O |
| InChI | InChI=1S/C16H11F2N3O4/c17-9-5-8-12(11(18)13(9)20-4-3-19-6-20)21(7-1-2-7)15(23)10(14(8)22)16(24)25/h3-7,10H,1-2H2,(H,24,25) |
| InChIKey | SJIFAXMFBVVMDK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|