C19H18FN3O3 — CID 10689540
ethyl 1-cyclopropyl-7-fluoro-8-imidazol-1-yl-9-methyl-4-oxoquinolizine-3-carboxylate (PubChem CID 10689540) has the molecular formula C19H18FN3O3 and a molecular weight of 355.37 g/mol. Its IUPAC name is ethyl 1-cyclopropyl-7-fluoro-8-imidazol-1-yl-9-methyl-4-oxoquinolizine-3-carboxylate.
| Compound Name | ethyl 1-cyclopropyl-7-fluoro-8-imidazol-1-yl-9-methyl-4-oxoquinolizine-3-carboxylate |
|---|---|
| PubChem CID | 10689540 |
| Molecular Formula | C19H18FN3O3 |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | ethyl 1-cyclopropyl-7-fluoro-8-imidazol-1-yl-9-methyl-4-oxoquinolizine-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C2CC2)c2c(C)c(-n3ccnc3)c(F)cn2c1=O |
| InChI | InChI=1S/C19H18FN3O3/c1-3-26-19(25)14-8-13(12-4-5-12)16-11(2)17(22-7-6-21-10-22)15(20)9-23(16)18(14)24/h6-10,12H,3-5H2,1-2H3 |
| InChIKey | MYKGTUGJESDLHM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |