C23H21NO4 — CID 23019700
ethyl 1-cyclopropyl-8-(4-formylphenyl)-9-methyl-4-oxoquinolizine-3-carboxylate (PubChem CID 23019700) has the molecular formula C23H21NO4 and a molecular weight of 375.42 g/mol. Its IUPAC name is ethyl 1-cyclopropyl-8-(4-formylphenyl)-9-methyl-4-oxoquinolizine-3-carboxylate.
| Compound Name | ethyl 1-cyclopropyl-8-(4-formylphenyl)-9-methyl-4-oxoquinolizine-3-carboxylate |
|---|---|
| PubChem CID | 23019700 |
| Molecular Formula | C23H21NO4 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | ethyl 1-cyclopropyl-8-(4-formylphenyl)-9-methyl-4-oxoquinolizine-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C2CC2)c2c(C)c(-c3ccc(C=O)cc3)ccn2c1=O |
| InChI | InChI=1S/C23H21NO4/c1-3-28-23(27)20-12-19(17-8-9-17)21-14(2)18(10-11-24(21)22(20)26)16-6-4-15(13-25)5-7-16/h4-7,10-13,17H,3,8-9H2,1-2H3 |
| InChIKey | HTAAEPSCABSMNX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|