C20H18N2O3 — CID 86696560
methyl 1-cyclopropyl-9-methyl-4-oxo-8-pyridin-3-ylquinolizine-3-carboxylate (PubChem CID 86696560) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is methyl 1-cyclopropyl-9-methyl-4-oxo-8-pyridin-3-ylquinolizine-3-carboxylate.
| Compound Name | methyl 1-cyclopropyl-9-methyl-4-oxo-8-pyridin-3-ylquinolizine-3-carboxylate |
|---|---|
| PubChem CID | 86696560 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | methyl 1-cyclopropyl-9-methyl-4-oxo-8-pyridin-3-ylquinolizine-3-carboxylate |
| SMILES | COC(=O)c1cc(C2CC2)c2c(C)c(-c3cccnc3)ccn2c1=O |
| InChI | InChI=1S/C20H18N2O3/c1-12-15(14-4-3-8-21-11-14)7-9-22-18(12)16(13-5-6-13)10-17(19(22)23)20(24)25-2/h3-4,7-11,13H,5-6H2,1-2H3 |
| InChIKey | KMXOIWUTIICXGE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |