C18H18FN3O2S — CID 66718445
9-cyclopropyl-6-fluoro-3-hydroxy-7-piperazin-1-ylthieno[2,3-b]quinolin-4-one (PubChem CID 66718445) has the molecular formula C18H18FN3O2S and a molecular weight of 359.43 g/mol. Its IUPAC name is 9-cyclopropyl-6-fluoro-3-hydroxy-7-piperazin-1-ylthieno[2,3-b]quinolin-4-one.
| Compound Name | 9-cyclopropyl-6-fluoro-3-hydroxy-7-piperazin-1-ylthieno[2,3-b]quinolin-4-one |
|---|---|
| PubChem CID | 66718445 |
| Molecular Formula | C18H18FN3O2S |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 9-cyclopropyl-6-fluoro-3-hydroxy-7-piperazin-1-ylthieno[2,3-b]quinolin-4-one |
| SMILES | O=c1c2cc(F)c(N3CCNCC3)cc2n(C2CC2)c2scc(O)c12 |
| InChI | InChI=1S/C18H18FN3O2S/c19-12-7-11-13(8-14(12)21-5-3-20-4-6-21)22(10-1-2-10)18-16(17(11)24)15(23)9-25-18/h7-10,20,23H,1-6H2 |
| InChIKey | BUTFRQACWKYYAW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|