C15H11F2NO2S — CID 58092837
9-cyclopropyl-6,7-difluoro-3-hydroxy-2-methylthieno[2,3-b]quinolin-4-one (PubChem CID 58092837) has the molecular formula C15H11F2NO2S and a molecular weight of 307.32 g/mol. Its IUPAC name is 9-cyclopropyl-6,7-difluoro-3-hydroxy-2-methylthieno[2,3-b]quinolin-4-one.
| Compound Name | 9-cyclopropyl-6,7-difluoro-3-hydroxy-2-methylthieno[2,3-b]quinolin-4-one |
|---|---|
| PubChem CID | 58092837 |
| Molecular Formula | C15H11F2NO2S |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 9-cyclopropyl-6,7-difluoro-3-hydroxy-2-methylthieno[2,3-b]quinolin-4-one |
| SMILES | Cc1sc2c(c1O)c(=O)c1cc(F)c(F)cc1n2C1CC1 |
| InChI | InChI=1S/C15H11F2NO2S/c1-6-13(19)12-14(20)8-4-9(16)10(17)5-11(8)18(7-2-3-7)15(12)21-6/h4-5,7,19H,2-3H2,1H3 |
| InChIKey | SDQCYQJMVXENJO-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|