C15H8F2N2O2S — CID 19365026
9-cyclopropyl-6,7-difluoro-3-hydroxy-4-oxothieno[2,3-b]quinoline-2-carbonitrile (PubChem CID 19365026) has the molecular formula C15H8F2N2O2S and a molecular weight of 318.30 g/mol. Its IUPAC name is 9-cyclopropyl-6,7-difluoro-3-hydroxy-4-oxothieno[2,3-b]quinoline-2-carbonitrile.
| Compound Name | 9-cyclopropyl-6,7-difluoro-3-hydroxy-4-oxothieno[2,3-b]quinoline-2-carbonitrile |
|---|---|
| PubChem CID | 19365026 |
| Molecular Formula | C15H8F2N2O2S |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 9-cyclopropyl-6,7-difluoro-3-hydroxy-4-oxothieno[2,3-b]quinoline-2-carbonitrile |
| SMILES | N#Cc1sc2c(c1O)c(=O)c1cc(F)c(F)cc1n2C1CC1 |
| InChI | InChI=1S/C15H8F2N2O2S/c16-8-3-7-10(4-9(8)17)19(6-1-2-6)15-12(13(7)20)14(21)11(5-18)22-15/h3-4,6,21H,1-2H2 |
| InChIKey | FUWCFWHBCZERNS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|