C20H18F2N4O3S — CID 46941230
9-cyclopropyl-8-(difluoromethoxy)-3-hydroxy-4-oxo-7-piperazin-1-ylthieno[2,3-b]quinoline-2-carbonitrile (PubChem CID 46941230) has the molecular formula C20H18F2N4O3S and a molecular weight of 432.45 g/mol. Its IUPAC name is 9-cyclopropyl-8-(difluoromethoxy)-3-hydroxy-4-oxo-7-piperazin-1-ylthieno[2,3-b]quinoline-2-carbonitrile.
| Compound Name | 9-cyclopropyl-8-(difluoromethoxy)-3-hydroxy-4-oxo-7-piperazin-1-ylthieno[2,3-b]quinoline-2-carbonitrile |
|---|---|
| PubChem CID | 46941230 |
| Molecular Formula | C20H18F2N4O3S |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 9-cyclopropyl-8-(difluoromethoxy)-3-hydroxy-4-oxo-7-piperazin-1-ylthieno[2,3-b]quinoline-2-carbonitrile |
| SMILES | N#Cc1sc2c(c1O)c(=O)c1ccc(N3CCNCC3)c(OC(F)F)c1n2C1CC1 |
| InChI | InChI=1S/C20H18F2N4O3S/c21-20(22)29-18-12(25-7-5-24-6-8-25)4-3-11-15(18)26(10-1-2-10)19-14(16(11)27)17(28)13(9-23)30-19/h3-4,10,20,24,28H,1-2,5-8H2 |
| InChIKey | LTNMJTLTXYOCIN-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|