C22H21FN4O4S — CID 46939997
1-(2-cyano-9-cyclopropyl-6-fluoro-3-hydroxy-8-methoxy-4-oxothieno[2,3-b]quinolin-7-yl)piperidine-3-carboxamide (PubChem CID 46939997) has the molecular formula C22H21FN4O4S and a molecular weight of 456.50 g/mol. Its IUPAC name is 1-(2-cyano-9-cyclopropyl-6-fluoro-3-hydroxy-8-methoxy-4-oxothieno[2,3-b]quinolin-7-yl)piperidine-3-carboxamide.
| Compound Name | 1-(2-cyano-9-cyclopropyl-6-fluoro-3-hydroxy-8-methoxy-4-oxothieno[2,3-b]quinolin-7-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 46939997 |
| Molecular Formula | C22H21FN4O4S |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 1-(2-cyano-9-cyclopropyl-6-fluoro-3-hydroxy-8-methoxy-4-oxothieno[2,3-b]quinolin-7-yl)piperidine-3-carboxamide |
| SMILES | COc1c(N2CCCC(C(N)=O)C2)c(F)cc2c(=O)c3c(O)c(C#N)sc3n(C3CC3)c12 |
| InChI | InChI=1S/C22H21FN4O4S/c1-31-20-16-12(7-13(23)17(20)26-6-2-3-10(9-26)21(25)30)18(28)15-19(29)14(8-24)32-22(15)27(16)11-4-5-11/h7,10-11,29H,2-6,9H2,1H3,(H2,25,30) |
| InChIKey | UPUFMYRLIZTZES-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 121.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|