C21H24FN3O5 — CID 54734831
7-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-1-cyclopropyl-6-fluoro-3-hydroxy-8-methoxy-4-oxoquinoline-2-carboxylic acid (PubChem CID 54734831) has the molecular formula C21H24FN3O5 and a molecular weight of 417.44 g/mol. Its IUPAC name is 7-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-1-cyclopropyl-6-fluoro-3-hydroxy-8-methoxy-4-oxoquinoline-2-carboxylic acid.
| Compound Name | 7-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-1-cyclopropyl-6-fluoro-3-hydroxy-8-methoxy-4-oxoquinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 54734831 |
| Molecular Formula | C21H24FN3O5 |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 7-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-1-cyclopropyl-6-fluoro-3-hydroxy-8-methoxy-4-oxoquinoline-2-carboxylic acid |
| SMILES | COc1c(N2CC3CCCNC3C2)c(F)cc2c(=O)c(O)c(C(=O)O)n(C3CC3)c12 |
| InChI | InChI=1S/C21H24FN3O5/c1-30-20-15-12(18(26)19(27)17(21(28)29)25(15)11-4-5-11)7-13(22)16(20)24-8-10-3-2-6-23-14(10)9-24/h7,10-11,14,23,27H,2-6,8-9H2,1H3,(H,28,29) |
| InChIKey | RNRGEYQNWFXMLA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |