C10H8ClNO — CID 131988217
1,4-dihydroquinoline-3-carbonyl chloride (PubChem CID 131988217) has the molecular formula C10H8ClNO and a molecular weight of 193.63 g/mol. Its IUPAC name is 1,4-dihydroquinoline-3-carbonyl chloride.
| Compound Name | 1,4-dihydroquinoline-3-carbonyl chloride |
|---|---|
| PubChem CID | 131988217 |
| Molecular Formula | C10H8ClNO |
| Molecular Weight | 193.63 g/mol |
| Exact Mass | 193.03 |
| IUPAC Name | 1,4-dihydroquinoline-3-carbonyl chloride |
| SMILES | O=C(Cl)C1=CNc2ccccc2C1 |
| InChI | InChI=1S/C10H8ClNO/c11-10(13)8-5-7-3-1-2-4-9(7)12-6-8/h1-4,6,12H,5H2 |
| InChIKey | AQOIZJNMUMHLIL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.63 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|