About 4H-furo[3,2-b]pyrrol-2-yldiazene
4H-furo[3,2-b]pyrrol-2-yldiazene (PubChem CID 162788568) has the molecular formula C6H5N3O
and a molecular weight of 135.13 g/mol. Its IUPAC name is 4H-furo[3,2-b]pyrrol-2-yldiazene.
Molecular Properties
| Compound Name | 4H-furo[3,2-b]pyrrol-2-yldiazene |
| PubChem CID | 162788568 |
| Molecular Formula | C6H5N3O |
| Molecular Weight | 135.13 g/mol |
| Exact Mass | 135.04 |
| IUPAC Name | 4H-furo[3,2-b]pyrrol-2-yldiazene |
| SMILES | [H]/N=N/c1cc2[nH]ccc2o1 |
| InChI | InChI=1S/C6H5N3O/c7-9-6-3-4-5(10-6)1-2-8-4/h1-3,7-8H/b9-7+ |
| InChIKey | AGDWLJBGJPIHKB-VQHVLOKHSA-N |
| XLogP | 2.42 |
| TPSA | 65.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.13 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4H-furo[3,2-b]pyrrol-2-yldiazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-furo[3,2-b]pyrrol-2-yldiazene?
The IUPAC name of 4H-furo[3,2-b]pyrrol-2-yldiazene (CID 162788568) is 4H-furo[3,2-b]pyrrol-2-yldiazene.
What is the SMILES notation for 4H-furo[3,2-b]pyrrol-2-yldiazene?
The canonical SMILES for 4H-furo[3,2-b]pyrrol-2-yldiazene is [H]/N=N/c1cc2[nH]ccc2o1.
What is the InChIKey of 4H-furo[3,2-b]pyrrol-2-yldiazene?
The InChIKey is AGDWLJBGJPIHKB-VQHVLOKHSA-N. The full InChI is InChI=1S/C6H5N3O/c7-9-6-3-4-5(10-6)1-2-8-4/h1-3,7-8H/b9-7+.
What are the key properties of 4H-furo[3,2-b]pyrrol-2-yldiazene?
4H-furo[3,2-b]pyrrol-2-yldiazene has a molecular weight of 135.13 g/mol, XLogP of 2.42, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-furo[3,2-b]pyrrol-2-yldiazene is sourced from PubChem (CID 162788568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).