C13H12N6 — CID 145071644
5-(1H-indole-5-carboximidoyl)pyrimidine-4,6-diamine (PubChem CID 145071644) has the molecular formula C13H12N6 and a molecular weight of 252.28 g/mol. Its IUPAC name is 5-(1H-indole-5-carboximidoyl)pyrimidine-4,6-diamine.
| Compound Name | 5-(1H-indole-5-carboximidoyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 145071644 |
| Molecular Formula | C13H12N6 |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 5-(1H-indole-5-carboximidoyl)pyrimidine-4,6-diamine |
| SMILES | [H]/N=C(\c1ccc2[nH]ccc2c1)c1c(N)ncnc1N |
| InChI | InChI=1S/C13H12N6/c14-11(10-12(15)18-6-19-13(10)16)8-1-2-9-7(5-8)3-4-17-9/h1-6,14,17H,(H4,15,16,18,19)/b14-11+ |
| InChIKey | WCEDDNPKMUMXMW-SDNWHVSQSA-N |
| XLogP | 1.54 |
| TPSA | 117.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|