C28H23N5O — CID 145388019
4-N-(2-methoxy-5-phenylphenyl)-5-(naphthalene-2-carboximidoyl)pyrimidine-4,6-diamine (PubChem CID 145388019) has the molecular formula C28H23N5O and a molecular weight of 445.53 g/mol. Its IUPAC name is 4-N-(2-methoxy-5-phenylphenyl)-5-(naphthalene-2-carboximidoyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-(2-methoxy-5-phenylphenyl)-5-(naphthalene-2-carboximidoyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 145388019 |
| Molecular Formula | C28H23N5O |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 4-N-(2-methoxy-5-phenylphenyl)-5-(naphthalene-2-carboximidoyl)pyrimidine-4,6-diamine |
| SMILES | [H]/N=C(\c1ccc2ccccc2c1)c1c(N)ncnc1Nc1cc(-c2ccccc2)ccc1OC |
| InChI | InChI=1S/C28H23N5O/c1-34-24-14-13-21(18-7-3-2-4-8-18)16-23(24)33-28-25(27(30)31-17-32-28)26(29)22-12-11-19-9-5-6-10-20(19)15-22/h2-17,29H,1H3,(H3,30,31,32,33)/b29-26+ |
| InChIKey | YHSBNULDFROZHE-PBBVDAKRSA-N |
| XLogP | 6.05 |
| TPSA | 96.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|