C22H25N5OS — CID 145388025
4-N-(5-cyclohexyl-2-methoxyphenyl)-5-(thiophene-3-carboximidoyl)pyrimidine-4,6-diamine (PubChem CID 145388025) has the molecular formula C22H25N5OS and a molecular weight of 407.54 g/mol. Its IUPAC name is 4-N-(5-cyclohexyl-2-methoxyphenyl)-5-(thiophene-3-carboximidoyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-(5-cyclohexyl-2-methoxyphenyl)-5-(thiophene-3-carboximidoyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 145388025 |
| Molecular Formula | C22H25N5OS |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 4-N-(5-cyclohexyl-2-methoxyphenyl)-5-(thiophene-3-carboximidoyl)pyrimidine-4,6-diamine |
| SMILES | [H]/N=C(\c1ccsc1)c1c(N)ncnc1Nc1cc(C2CCCCC2)ccc1OC |
| InChI | InChI=1S/C22H25N5OS/c1-28-18-8-7-15(14-5-3-2-4-6-14)11-17(18)27-22-19(21(24)25-13-26-22)20(23)16-9-10-29-12-16/h7-14,23H,2-6H2,1H3,(H3,24,25,26,27)/b23-20+ |
| InChIKey | LVZQWJKOTNOUMO-BSYVCWPDSA-N |
| XLogP | 5.34 |
| TPSA | 96.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|