C24H23N7O3 — CID 144842510
N-[2-[[6-amino-5-(3-hydroxy-4-methoxybenzenecarboximidoyl)pyrimidin-4-yl]amino]ethyl]-2-cyano-N-phenylprop-2-enamide (PubChem CID 144842510) has the molecular formula C24H23N7O3 and a molecular weight of 457.49 g/mol. Its IUPAC name is N-[2-[[6-amino-5-(3-hydroxy-4-methoxybenzenecarboximidoyl)pyrimidin-4-yl]amino]ethyl]-2-cyano-N-phenylprop-2-enamide.
| Compound Name | N-[2-[[6-amino-5-(3-hydroxy-4-methoxybenzenecarboximidoyl)pyrimidin-4-yl]amino]ethyl]-2-cyano-N-phenylprop-2-enamide |
|---|---|
| PubChem CID | 144842510 |
| Molecular Formula | C24H23N7O3 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | N-[2-[[6-amino-5-(3-hydroxy-4-methoxybenzenecarboximidoyl)pyrimidin-4-yl]amino]ethyl]-2-cyano-N-phenylprop-2-enamide |
| SMILES | [H]/N=C(\c1ccc(OC)c(O)c1)c1c(N)ncnc1NCCN(C(=O)C(=C)C#N)c1ccccc1 |
| InChI | InChI=1S/C24H23N7O3/c1-15(13-25)24(33)31(17-6-4-3-5-7-17)11-10-28-23-20(22(27)29-14-30-23)21(26)16-8-9-19(34-2)18(32)12-16/h3-9,12,14,26,32H,1,10-11H2,2H3,(H3,27,28,29,30)/b26-21+ |
| InChIKey | NLNKCYOWGZOMJA-YYADALCUSA-N |
| XLogP | 2.71 |
| TPSA | 161.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|