C29H29ClFN7O2 — CID 166988487
N-[2-[[6-amino-5-(3-fluoro-4-methoxybenzenecarboximidoyl)pyrimidin-4-yl]amino]-1-(3-chloro-2-methylanilino)propyl]-N-phenylformamide (PubChem CID 166988487) has the molecular formula C29H29ClFN7O2 and a molecular weight of 562.05 g/mol. Its IUPAC name is N-[2-[[6-amino-5-(3-fluoro-4-methoxybenzenecarboximidoyl)pyrimidin-4-yl]amino]-1-(3-chloro-2-methylanilino)propyl]-N-phenylformamide.
| Compound Name | N-[2-[[6-amino-5-(3-fluoro-4-methoxybenzenecarboximidoyl)pyrimidin-4-yl]amino]-1-(3-chloro-2-methylanilino)propyl]-N-phenylformamide |
|---|---|
| PubChem CID | 166988487 |
| Molecular Formula | C29H29ClFN7O2 |
| Molecular Weight | 562.05 g/mol |
| Exact Mass | 561.21 |
| IUPAC Name | N-[2-[[6-amino-5-(3-fluoro-4-methoxybenzenecarboximidoyl)pyrimidin-4-yl]amino]-1-(3-chloro-2-methylanilino)propyl]-N-phenylformamide |
| SMILES | [H]/N=C(\c1ccc(OC)c(F)c1)c1c(N)ncnc1NC(C)C(Nc1cccc(Cl)c1C)N(C=O)c1ccccc1 |
| InChI | InChI=1S/C29H29ClFN7O2/c1-17-21(30)10-7-11-23(17)37-29(38(16-39)20-8-5-4-6-9-20)18(2)36-28-25(27(33)34-15-35-28)26(32)19-12-13-24(40-3)22(31)14-19/h4-16,18,29,32,37H,1-3H3,(H3,33,34,35,36)/b32-26+ |
| InChIKey | DRUYSGCAOPVNNR-HMZBKAONSA-N |
| XLogP | 5.49 |
| TPSA | 129.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.05 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|