C12H10F3N5O — CID 123591076
5-[4-(difluoromethoxy)-3-fluorobenzenecarboximidoyl]pyrimidine-4,6-diamine (PubChem CID 123591076) has the molecular formula C12H10F3N5O and a molecular weight of 297.24 g/mol. Its IUPAC name is 5-[4-(difluoromethoxy)-3-fluorobenzenecarboximidoyl]pyrimidine-4,6-diamine.
| Compound Name | 5-[4-(difluoromethoxy)-3-fluorobenzenecarboximidoyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 123591076 |
| Molecular Formula | C12H10F3N5O |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 5-[4-(difluoromethoxy)-3-fluorobenzenecarboximidoyl]pyrimidine-4,6-diamine |
| SMILES | [H]/N=C(\c1ccc(OC(F)F)c(F)c1)c1c(N)ncnc1N |
| InChI | InChI=1S/C12H10F3N5O/c13-6-3-5(1-2-7(6)21-12(14)15)9(16)8-10(17)19-4-20-11(8)18/h1-4,12,16H,(H4,17,18,19,20)/b16-9+ |
| InChIKey | GGXLLEXEBKSOQA-CXUHLZMHSA-N |
| XLogP | 1.80 |
| TPSA | 110.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|