C11H13N3 — CID 173254114
3-(1H-indol-6-yl)propanimidamide (PubChem CID 173254114) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is 3-(1H-indol-6-yl)propanimidamide.
| Compound Name | 3-(1H-indol-6-yl)propanimidamide |
|---|---|
| PubChem CID | 173254114 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 3-(1H-indol-6-yl)propanimidamide |
| SMILES | [H]/N=C(\N)CCc1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C11H13N3/c12-11(13)4-2-8-1-3-9-5-6-14-10(9)7-8/h1,3,5-7,14H,2,4H2,(H3,12,13) |
| InChIKey | VJSHNTGJEJTLKG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 65.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|