C16H13F2N — CID 175599015
6-[2-(3,4-difluorophenyl)ethyl]-1H-indole (PubChem CID 175599015) has the molecular formula C16H13F2N and a molecular weight of 257.28 g/mol. Its IUPAC name is 6-[2-(3,4-difluorophenyl)ethyl]-1H-indole.
| Compound Name | 6-[2-(3,4-difluorophenyl)ethyl]-1H-indole |
|---|---|
| PubChem CID | 175599015 |
| Molecular Formula | C16H13F2N |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 6-[2-(3,4-difluorophenyl)ethyl]-1H-indole |
| SMILES | Fc1ccc(CCc2ccc3cc[nH]c3c2)cc1F |
| InChI | InChI=1S/C16H13F2N/c17-14-6-4-11(9-15(14)18)1-2-12-3-5-13-7-8-19-16(13)10-12/h3-10,19H,1-2H2 |
| InChIKey | CBIZAYYLTCFCIA-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |