C9H6N2O — CID 22599152
5H-pyrrolo[3,2-f][1,3]benzoxazole (PubChem CID 22599152) has the molecular formula C9H6N2O and a molecular weight of 158.16 g/mol. Its IUPAC name is 5H-pyrrolo[3,2-f][1,3]benzoxazole.
| Compound Name | 5H-pyrrolo[3,2-f][1,3]benzoxazole |
|---|---|
| PubChem CID | 22599152 |
| Molecular Formula | C9H6N2O |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | 5H-pyrrolo[3,2-f][1,3]benzoxazole |
| SMILES | c1cc2cc3ncoc3cc2[nH]1 |
| InChI | InChI=1S/C9H6N2O/c1-2-10-7-4-9-8(3-6(1)7)11-5-12-9/h1-5,10H |
| InChIKey | ITNYOYQGOBUCOE-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |