C7H5FN2 — CID 53399661
5-fluoro-1H-pyrrolo[2,3-c]pyridine (PubChem CID 53399661) has the molecular formula C7H5FN2 and a molecular weight of 136.13 g/mol. Its IUPAC name is 5-fluoro-1H-pyrrolo[2,3-c]pyridine.
| Compound Name | 5-fluoro-1H-pyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 53399661 |
| Molecular Formula | C7H5FN2 |
| Molecular Weight | 136.13 g/mol |
| Exact Mass | 136.04 |
| IUPAC Name | 5-fluoro-1H-pyrrolo[2,3-c]pyridine |
| SMILES | Fc1cc2cc[nH]c2cn1 |
| InChI | InChI=1S/C7H5FN2/c8-7-3-5-1-2-9-6(5)4-10-7/h1-4,9H |
| InChIKey | GOWCYYDVGZXHSM-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.13 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|