About CID 143215043
CID 143215043 (PubChem CID 143215043) has the molecular formula C7H5AlN2
and a molecular weight of 144.11 g/mol.
Molecular Properties
| Compound Name | CID 143215043 |
| PubChem CID | 143215043 |
| Molecular Formula | C7H5AlN2 |
| Molecular Weight | 144.11 g/mol |
| Exact Mass | 144.03 |
| IUPAC Name | — |
| SMILES | [Al]c1cc2cc[nH]c2cn1 |
| InChI | InChI=1S/C7H5N2.Al/c1-3-8-5-7-6(1)2-4-9-7;/h1-2,4-5,9H; |
| InChIKey | VIAYGAOUPOOUQK-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.11 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 143215043 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 143215043?
The IUPAC name of CID 143215043 (CID 143215043) is not available.
What is the SMILES notation for CID 143215043?
The canonical SMILES for CID 143215043 is [Al]c1cc2cc[nH]c2cn1.
What is the InChIKey of CID 143215043?
The InChIKey is VIAYGAOUPOOUQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N2.Al/c1-3-8-5-7-6(1)2-4-9-7;/h1-2,4-5,9H;.
What are the key properties of CID 143215043?
CID 143215043 has a molecular weight of 144.11 g/mol, XLogP of 0.36, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 143215043 is sourced from PubChem (CID 143215043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).