C7H7N2P — CID 138713057
1H-pyrrolo[3,2-c]pyridin-6-ylphosphane (PubChem CID 138713057) has the molecular formula C7H7N2P and a molecular weight of 150.12 g/mol. Its IUPAC name is 1H-pyrrolo[3,2-c]pyridin-6-ylphosphane.
| Compound Name | 1H-pyrrolo[3,2-c]pyridin-6-ylphosphane |
|---|---|
| PubChem CID | 138713057 |
| Molecular Formula | C7H7N2P |
| Molecular Weight | 150.12 g/mol |
| Exact Mass | 150.03 |
| IUPAC Name | 1H-pyrrolo[3,2-c]pyridin-6-ylphosphane |
| SMILES | Pc1cc2[nH]ccc2cn1 |
| InChI | InChI=1S/C7H7N2P/c10-7-3-6-5(4-9-7)1-2-8-6/h1-4,8H,10H2 |
| InChIKey | BAUWLRDPGSPZMZ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.12 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|