About 1H-pyrrolo[3,2-c]pyridin-6-ylphosphane
1H-pyrrolo[3,2-c]pyridin-6-ylphosphane (PubChem CID 138713057) has the molecular formula C7H7N2P
and a molecular weight of 150.12 g/mol. Its IUPAC name is 1H-pyrrolo[3,2-c]pyridin-6-ylphosphane.
Molecular Properties
| Compound Name | 1H-pyrrolo[3,2-c]pyridin-6-ylphosphane |
| PubChem CID | 138713057 |
| Molecular Formula | C7H7N2P |
| Molecular Weight | 150.12 g/mol |
| Exact Mass | 150.03 |
| IUPAC Name | 1H-pyrrolo[3,2-c]pyridin-6-ylphosphane |
| SMILES | Pc1cc2[nH]ccc2cn1 |
| InChI | InChI=1S/C7H7N2P/c10-7-3-6-5(4-9-7)1-2-8-6/h1-4,8H,10H2 |
| InChIKey | BAUWLRDPGSPZMZ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.12 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1H-pyrrolo[3,2-c]pyridin-6-ylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrrolo[3,2-c]pyridin-6-ylphosphane?
The IUPAC name of 1H-pyrrolo[3,2-c]pyridin-6-ylphosphane (CID 138713057) is 1H-pyrrolo[3,2-c]pyridin-6-ylphosphane.
What is the SMILES notation for 1H-pyrrolo[3,2-c]pyridin-6-ylphosphane?
The canonical SMILES for 1H-pyrrolo[3,2-c]pyridin-6-ylphosphane is Pc1cc2[nH]ccc2cn1.
What is the InChIKey of 1H-pyrrolo[3,2-c]pyridin-6-ylphosphane?
The InChIKey is BAUWLRDPGSPZMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N2P/c10-7-3-6-5(4-9-7)1-2-8-6/h1-4,8H,10H2.
What are the key properties of 1H-pyrrolo[3,2-c]pyridin-6-ylphosphane?
1H-pyrrolo[3,2-c]pyridin-6-ylphosphane has a molecular weight of 150.12 g/mol, XLogP of 1.06, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrrolo[3,2-c]pyridin-6-ylphosphane is sourced from PubChem (CID 138713057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).