C10H9N3O — CID 118117566
N-(1H-pyrrolo[3,2-c]pyridin-6-yl)prop-2-enamide (PubChem CID 118117566) has the molecular formula C10H9N3O and a molecular weight of 187.20 g/mol. Its IUPAC name is N-(1H-pyrrolo[3,2-c]pyridin-6-yl)prop-2-enamide.
| Compound Name | N-(1H-pyrrolo[3,2-c]pyridin-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 118117566 |
| Molecular Formula | C10H9N3O |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | N-(1H-pyrrolo[3,2-c]pyridin-6-yl)prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc2[nH]ccc2cn1 |
| InChI | InChI=1S/C10H9N3O/c1-2-10(14)13-9-5-8-7(6-12-9)3-4-11-8/h2-6,11H,1H2,(H,12,13,14) |
| InChIKey | NYMRTYNAZSYVPA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|