C13H13N3O4 — CID 134294558
methyl 2,6-bis(prop-2-enoylamino)pyridine-4-carboxylate (PubChem CID 134294558) has the molecular formula C13H13N3O4 and a molecular weight of 275.26 g/mol. Its IUPAC name is methyl 2,6-bis(prop-2-enoylamino)pyridine-4-carboxylate.
| Compound Name | methyl 2,6-bis(prop-2-enoylamino)pyridine-4-carboxylate |
|---|---|
| PubChem CID | 134294558 |
| Molecular Formula | C13H13N3O4 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | methyl 2,6-bis(prop-2-enoylamino)pyridine-4-carboxylate |
| SMILES | C=CC(=O)Nc1cc(C(=O)OC)cc(NC(=O)C=C)n1 |
| InChI | InChI=1S/C13H13N3O4/c1-4-11(17)15-9-6-8(13(19)20-3)7-10(14-9)16-12(18)5-2/h4-7H,1-2H2,3H3,(H2,14,15,16,17,18) |
| InChIKey | FDOJBTWAVCOAGF-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|