methyl 2,6-bis(prop-2-enoylamino)pyridine-4-carboxylate

C13H13N3O4 — CID 134294558

IUPACmethyl 2,6-bis(prop-2-enoylamino)pyridine-4-carboxylate
SMILESC=CC(=O)Nc1cc(C(=O)OC)cc(NC(=O)C=C)n1
InChIInChI=1S/C13H13N3O4/c1-4-11(17)15-9-6-8(13(19)20-3)7-10(14-9)16-12(18)5-2/h4-7H,1-2H2,3H3,(H2,14,15,16,17,18)
InChIKeyFDOJBTWAVCOAGF-UHFFFAOYSA-N
MW275.26 g/mol
LogP1.12
Rot. Bonds5

About methyl 2,6-bis(prop-2-enoylamino)pyridine-4-carboxylate

methyl 2,6-bis(prop-2-enoylamino)pyridine-4-carboxylate (PubChem CID 134294558) has the molecular formula C13H13N3O4 and a molecular weight of 275.26 g/mol. Its IUPAC name is methyl 2,6-bis(prop-2-enoylamino)pyridine-4-carboxylate.

Molecular Properties

Compound Namemethyl 2,6-bis(prop-2-enoylamino)pyridine-4-carboxylate
PubChem CID134294558
Molecular FormulaC13H13N3O4
Molecular Weight275.26 g/mol
Exact Mass275.09
IUPAC Namemethyl 2,6-bis(prop-2-enoylamino)pyridine-4-carboxylate
SMILESC=CC(=O)Nc1cc(C(=O)OC)cc(NC(=O)C=C)n1
InChIInChI=1S/C13H13N3O4/c1-4-11(17)15-9-6-8(13(19)20-3)7-10(14-9)16-12(18)5-2/h4-7H,1-2H2,3H3,(H2,14,15,16,17,18)
InChIKeyFDOJBTWAVCOAGF-UHFFFAOYSA-N
XLogP1.12
TPSA97.39 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.26
LogP ≤ 51.12
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl 2,6-bis(prop-2-enoylamino)pyridine-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,6-bis(prop-2-enoylamino)pyridine-4-carboxylate?
The IUPAC name of methyl 2,6-bis(prop-2-enoylamino)pyridine-4-carboxylate (CID 134294558) is methyl 2,6-bis(prop-2-enoylamino)pyridine-4-carboxylate.
What is the SMILES notation for methyl 2,6-bis(prop-2-enoylamino)pyridine-4-carboxylate?
The canonical SMILES for methyl 2,6-bis(prop-2-enoylamino)pyridine-4-carboxylate is C=CC(=O)Nc1cc(C(=O)OC)cc(NC(=O)C=C)n1.
What is the InChIKey of methyl 2,6-bis(prop-2-enoylamino)pyridine-4-carboxylate?
The InChIKey is FDOJBTWAVCOAGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O4/c1-4-11(17)15-9-6-8(13(19)20-3)7-10(14-9)16-12(18)5-2/h4-7H,1-2H2,3H3,(H2,14,15,16,17,18).
What are the key properties of methyl 2,6-bis(prop-2-enoylamino)pyridine-4-carboxylate?
methyl 2,6-bis(prop-2-enoylamino)pyridine-4-carboxylate has a molecular weight of 275.26 g/mol, XLogP of 1.12, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,6-bis(prop-2-enoylamino)pyridine-4-carboxylate is sourced from PubChem (CID 134294558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).