C8H8N2O3S — CID 153387484
methyl 2-(prop-2-enoylamino)-1,3-thiazole-4-carboxylate (PubChem CID 153387484) has the molecular formula C8H8N2O3S and a molecular weight of 212.23 g/mol. Its IUPAC name is methyl 2-(prop-2-enoylamino)-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-(prop-2-enoylamino)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 153387484 |
| Molecular Formula | C8H8N2O3S |
| Molecular Weight | 212.23 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | methyl 2-(prop-2-enoylamino)-1,3-thiazole-4-carboxylate |
| SMILES | C=CC(=O)Nc1nc(C(=O)OC)cs1 |
| InChI | InChI=1S/C8H8N2O3S/c1-3-6(11)10-8-9-5(4-14-8)7(12)13-2/h3-4H,1H2,2H3,(H,9,10,11) |
| InChIKey | YQXSCBPPEMEYGZ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.23 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|