C20H25N5O6 — CID 134298272
(2S)-2-[[(2S)-2-[[2,6-bis(prop-2-enoylamino)pyridine-4-carbonyl]amino]-3-methylbutanoyl]amino]propanoic acid (PubChem CID 134298272) has the molecular formula C20H25N5O6 and a molecular weight of 431.45 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[2,6-bis(prop-2-enoylamino)pyridine-4-carbonyl]amino]-3-methylbutanoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[2,6-bis(prop-2-enoylamino)pyridine-4-carbonyl]amino]-3-methylbutanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 134298272 |
| Molecular Formula | C20H25N5O6 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[2,6-bis(prop-2-enoylamino)pyridine-4-carbonyl]amino]-3-methylbutanoyl]amino]propanoic acid |
| SMILES | C=CC(=O)Nc1cc(C(=O)N[C@H](C(=O)N[C@@H](C)C(=O)O)C(C)C)cc(NC(=O)C=C)n1 |
| InChI | InChI=1S/C20H25N5O6/c1-6-15(26)23-13-8-12(9-14(22-13)24-16(27)7-2)18(28)25-17(10(3)4)19(29)21-11(5)20(30)31/h6-11,17H,1-2H2,3-5H3,(H,21,29)(H,25,28)(H,30,31)(H2,22,23,24,26,27)/t11-,17-/m0/s1 |
| InChIKey | RWESIAJNBPEELQ-GTNSWQLSSA-N |
| XLogP | 0.67 |
| TPSA | 166.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|