About 6-(1H-pyrrolo[2,3-c]pyridin-4-yl)-1,3-benzoxazole
6-(1H-pyrrolo[2,3-c]pyridin-4-yl)-1,3-benzoxazole (PubChem CID 171099892) has the molecular formula C14H9N3O
and a molecular weight of 235.25 g/mol. Its IUPAC name is 6-(1H-pyrrolo[2,3-c]pyridin-4-yl)-1,3-benzoxazole.
Molecular Properties
| Compound Name | 6-(1H-pyrrolo[2,3-c]pyridin-4-yl)-1,3-benzoxazole |
| PubChem CID | 171099892 |
| Molecular Formula | C14H9N3O |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 6-(1H-pyrrolo[2,3-c]pyridin-4-yl)-1,3-benzoxazole |
| SMILES | c1cc2c(-c3ccc4ncoc4c3)cncc2[nH]1 |
| InChI | InChI=1S/C14H9N3O/c1-2-12-14(18-8-17-12)5-9(1)11-6-15-7-13-10(11)3-4-16-13/h1-8,16H |
| InChIKey | OSTPFUJWVAAKGZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(1H-pyrrolo[2,3-c]pyridin-4-yl)-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1H-pyrrolo[2,3-c]pyridin-4-yl)-1,3-benzoxazole?
The IUPAC name of 6-(1H-pyrrolo[2,3-c]pyridin-4-yl)-1,3-benzoxazole (CID 171099892) is 6-(1H-pyrrolo[2,3-c]pyridin-4-yl)-1,3-benzoxazole.
What is the SMILES notation for 6-(1H-pyrrolo[2,3-c]pyridin-4-yl)-1,3-benzoxazole?
The canonical SMILES for 6-(1H-pyrrolo[2,3-c]pyridin-4-yl)-1,3-benzoxazole is c1cc2c(-c3ccc4ncoc4c3)cncc2[nH]1.
What is the InChIKey of 6-(1H-pyrrolo[2,3-c]pyridin-4-yl)-1,3-benzoxazole?
The InChIKey is OSTPFUJWVAAKGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9N3O/c1-2-12-14(18-8-17-12)5-9(1)11-6-15-7-13-10(11)3-4-16-13/h1-8,16H.
What are the key properties of 6-(1H-pyrrolo[2,3-c]pyridin-4-yl)-1,3-benzoxazole?
6-(1H-pyrrolo[2,3-c]pyridin-4-yl)-1,3-benzoxazole has a molecular weight of 235.25 g/mol, XLogP of 3.37, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1H-pyrrolo[2,3-c]pyridin-4-yl)-1,3-benzoxazole is sourced from PubChem (CID 171099892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).