C12H9NO2 — CID 11708244
9-methyl-3H-pyrano[3,2-e]indol-7-one (PubChem CID 11708244) has the molecular formula C12H9NO2 and a molecular weight of 199.21 g/mol. Its IUPAC name is 9-methyl-3H-pyrano[3,2-e]indol-7-one.
| Compound Name | 9-methyl-3H-pyrano[3,2-e]indol-7-one |
|---|---|
| PubChem CID | 11708244 |
| Molecular Formula | C12H9NO2 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 9-methyl-3H-pyrano[3,2-e]indol-7-one |
| SMILES | Cc1cc(=O)oc2ccc3[nH]ccc3c12 |
| InChI | InChI=1S/C12H9NO2/c1-7-6-11(14)15-10-3-2-9-8(12(7)10)4-5-13-9/h2-6,13H,1H3 |
| InChIKey | YLBBZYSJXKWECG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|