C12H9NO2 — CID 729413
4-methyl-9H-pyrano[2,3-b]indol-2-one (PubChem CID 729413) has the molecular formula C12H9NO2 and a molecular weight of 199.21 g/mol. Its IUPAC name is 4-methyl-9H-pyrano[2,3-b]indol-2-one.
| Compound Name | 4-methyl-9H-pyrano[2,3-b]indol-2-one |
|---|---|
| PubChem CID | 729413 |
| Molecular Formula | C12H9NO2 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 4-methyl-9H-pyrano[2,3-b]indol-2-one |
| SMILES | Cc1cc(=O)oc2[nH]c3ccccc3c12 |
| InChI | InChI=1S/C12H9NO2/c1-7-6-10(14)15-12-11(7)8-4-2-3-5-9(8)13-12/h2-6,13H,1H3 |
| InChIKey | SVKYQDMWTBAULP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |