C19H11N3O2 — CID 10064156
12-oxa-3,14,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1(16),2(10),4,6,8,11(15),17,19,21-nonaen-13-one (PubChem CID 10064156) has the molecular formula C19H11N3O2 and a molecular weight of 313.32 g/mol. Its IUPAC name is 12-oxa-3,14,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1(16),2(10),4,6,8,11(15),17,19,21-nonaen-13-one.
| Compound Name | 12-oxa-3,14,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1(16),2(10),4,6,8,11(15),17,19,21-nonaen-13-one |
|---|---|
| PubChem CID | 10064156 |
| Molecular Formula | C19H11N3O2 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 12-oxa-3,14,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1(16),2(10),4,6,8,11(15),17,19,21-nonaen-13-one |
| SMILES | O=c1[nH]c2c(o1)c1c3ccccc3[nH]c1c1[nH]c3ccccc3c12 |
| InChI | InChI=1S/C19H11N3O2/c23-19-22-17-13-9-5-1-3-7-11(9)20-15(13)16-14(18(17)24-19)10-6-2-4-8-12(10)21-16/h1-8,20-21H,(H,22,23) |
| InChIKey | JGOHVXVAWLSFIK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |