C8H6ClNO3 — CID 142025242
1H-3,1-benzoxazine-2,4-dione;hydrochloride (PubChem CID 142025242) has the molecular formula C8H6ClNO3 and a molecular weight of 199.59 g/mol. Its IUPAC name is 1H-3,1-benzoxazine-2,4-dione;hydrochloride.
| Compound Name | 1H-3,1-benzoxazine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 142025242 |
| Molecular Formula | C8H6ClNO3 |
| Molecular Weight | 199.59 g/mol |
| Exact Mass | 199.00 |
| IUPAC Name | 1H-3,1-benzoxazine-2,4-dione;hydrochloride |
| SMILES | Cl.O=c1[nH]c2ccccc2c(=O)o1 |
| InChI | InChI=1S/C8H5NO3.ClH/c10-7-5-3-1-2-4-6(5)9-8(11)12-7;/h1-4H,(H,9,11);1H |
| InChIKey | REQOOLBIFMLTNS-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 63.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.59 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |