C7H8AsNO6 — CID 160734484
arsoric acid;3H-1,3-benzoxazol-2-one (PubChem CID 160734484) has the molecular formula C7H8AsNO6 and a molecular weight of 277.06 g/mol. Its IUPAC name is arsoric acid;3H-1,3-benzoxazol-2-one.
| Compound Name | arsoric acid;3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 160734484 |
| Molecular Formula | C7H8AsNO6 |
| Molecular Weight | 277.06 g/mol |
| Exact Mass | 276.96 |
| IUPAC Name | arsoric acid;3H-1,3-benzoxazol-2-one |
| SMILES | O=[As](O)(O)O.O=c1[nH]c2ccccc2o1 |
| InChI | InChI=1S/C7H5NO2.AsH3O4/c9-7-8-5-3-1-2-4-6(5)10-7;2-1(3,4)5/h1-4H,(H,8,9);(H3,2,3,4,5) |
| InChIKey | RUTRLIBMCIRSAC-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.06 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|