C10H15NO2 — CID 142031035
3H-1,3-benzoxazol-2-one;ethane;methane (PubChem CID 142031035) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is 3H-1,3-benzoxazol-2-one;ethane;methane.
| Compound Name | 3H-1,3-benzoxazol-2-one;ethane;methane |
|---|---|
| PubChem CID | 142031035 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 3H-1,3-benzoxazol-2-one;ethane;methane |
| SMILES | C.CC.O=c1[nH]c2ccccc2o1 |
| InChI | InChI=1S/C7H5NO2.C2H6.CH4/c9-7-8-5-3-1-2-4-6(5)10-7;1-2;/h1-4H,(H,8,9);1-2H3;1H4 |
| InChIKey | XUBQAGPCHIEKCU-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |