About 7-methyl-3H-1,3-benzoxazol-2-one;propane
7-methyl-3H-1,3-benzoxazol-2-one;propane (PubChem CID 142969733) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is 7-methyl-3H-1,3-benzoxazol-2-one;propane.
Molecular Properties
| Compound Name | 7-methyl-3H-1,3-benzoxazol-2-one;propane |
| PubChem CID | 142969733 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 7-methyl-3H-1,3-benzoxazol-2-one;propane |
| SMILES | CCC.Cc1cccc2[nH]c(=O)oc12 |
| InChI | InChI=1S/C8H7NO2.C3H8/c1-5-3-2-4-6-7(5)11-8(10)9-6;1-3-2/h2-4H,1H3,(H,9,10);3H2,1-2H3 |
| InChIKey | XENCVRGTLNQZCE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methyl-3H-1,3-benzoxazol-2-one;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-3H-1,3-benzoxazol-2-one;propane?
The IUPAC name of 7-methyl-3H-1,3-benzoxazol-2-one;propane (CID 142969733) is 7-methyl-3H-1,3-benzoxazol-2-one;propane.
What is the SMILES notation for 7-methyl-3H-1,3-benzoxazol-2-one;propane?
The canonical SMILES for 7-methyl-3H-1,3-benzoxazol-2-one;propane is CCC.Cc1cccc2[nH]c(=O)oc12.
What is the InChIKey of 7-methyl-3H-1,3-benzoxazol-2-one;propane?
The InChIKey is XENCVRGTLNQZCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO2.C3H8/c1-5-3-2-4-6-7(5)11-8(10)9-6;1-3-2/h2-4H,1H3,(H,9,10);3H2,1-2H3.
What are the key properties of 7-methyl-3H-1,3-benzoxazol-2-one;propane?
7-methyl-3H-1,3-benzoxazol-2-one;propane has a molecular weight of 193.25 g/mol, XLogP of 2.85, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-3H-1,3-benzoxazol-2-one;propane is sourced from PubChem (CID 142969733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).