C8H7NO3 — CID 84652015
5-hydroxy-7-methyl-3H-1,3-benzoxazol-2-one (PubChem CID 84652015) has the molecular formula C8H7NO3 and a molecular weight of 165.15 g/mol. Its IUPAC name is 5-hydroxy-7-methyl-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-hydroxy-7-methyl-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 84652015 |
| Molecular Formula | C8H7NO3 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | 5-hydroxy-7-methyl-3H-1,3-benzoxazol-2-one |
| SMILES | Cc1cc(O)cc2[nH]c(=O)oc12 |
| InChI | InChI=1S/C8H7NO3/c1-4-2-5(10)3-6-7(4)12-8(11)9-6/h2-3,10H,1H3,(H,9,11) |
| InChIKey | UKTIIIWQHWFCAT-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 66.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |