C9H8N2O3 — CID 82095318
5-acetyl-7-amino-3H-1,3-benzoxazol-2-one (PubChem CID 82095318) has the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. Its IUPAC name is 5-acetyl-7-amino-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-acetyl-7-amino-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 82095318 |
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 5-acetyl-7-amino-3H-1,3-benzoxazol-2-one |
| SMILES | CC(=O)c1cc(N)c2oc(=O)[nH]c2c1 |
| InChI | InChI=1S/C9H8N2O3/c1-4(12)5-2-6(10)8-7(3-5)11-9(13)14-8/h2-3H,10H2,1H3,(H,11,13) |
| InChIKey | KQQTXZFDVJLIOS-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 89.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|