C7H6N2O3 — CID 84652280
7-amino-5-hydroxy-3H-1,3-benzoxazol-2-one (PubChem CID 84652280) has the molecular formula C7H6N2O3 and a molecular weight of 166.14 g/mol. Its IUPAC name is 7-amino-5-hydroxy-3H-1,3-benzoxazol-2-one.
| Compound Name | 7-amino-5-hydroxy-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 84652280 |
| Molecular Formula | C7H6N2O3 |
| Molecular Weight | 166.14 g/mol |
| Exact Mass | 166.04 |
| IUPAC Name | 7-amino-5-hydroxy-3H-1,3-benzoxazol-2-one |
| SMILES | Nc1cc(O)cc2[nH]c(=O)oc12 |
| InChI | InChI=1S/C7H6N2O3/c8-4-1-3(10)2-5-6(4)12-7(11)9-5/h1-2,10H,8H2,(H,9,11) |
| InChIKey | BFEGSOVLXZSRGU-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 92.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.14 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|