C7H4INO2 — CID 130784539
7-iodo-3H-1,3-benzoxazol-2-one (PubChem CID 130784539) has the molecular formula C7H4INO2 and a molecular weight of 261.02 g/mol. Its IUPAC name is 7-iodo-3H-1,3-benzoxazol-2-one.
| Compound Name | 7-iodo-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 130784539 |
| Molecular Formula | C7H4INO2 |
| Molecular Weight | 261.02 g/mol |
| Exact Mass | 260.93 |
| IUPAC Name | 7-iodo-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2cccc(I)c2o1 |
| InChI | InChI=1S/C7H4INO2/c8-4-2-1-3-5-6(4)11-7(10)9-5/h1-3H,(H,9,10) |
| InChIKey | SKEGJOZISGXJPM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.02 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|