C7H8N2O2 — CID 136967101
3-ethanimidoyl-4-hydroxy-1H-pyridin-2-one (PubChem CID 136967101) has the molecular formula C7H8N2O2 and a molecular weight of 152.15 g/mol. Its IUPAC name is 3-ethanimidoyl-4-hydroxy-1H-pyridin-2-one.
| Compound Name | 3-ethanimidoyl-4-hydroxy-1H-pyridin-2-one |
|---|---|
| PubChem CID | 136967101 |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | 3-ethanimidoyl-4-hydroxy-1H-pyridin-2-one |
| SMILES | [H]/N=C(\C)c1c(O)cc[nH]c1=O |
| InChI | InChI=1S/C7H8N2O2/c1-4(8)6-5(10)2-3-9-7(6)11/h2-3,8H,1H3,(H2,9,10,11)/b8-4+ |
| InChIKey | KHQULEPWSPURRH-XBXARRHUSA-N |
| XLogP | 0.47 |
| TPSA | 76.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|