C18H16N2O4 — CID 141453996
4-hydroxy-3-[(4-hydroxy-2-oxo-1H-pyridin-3-yl)-(4-methylphenyl)methyl]-1H-pyridin-2-one (PubChem CID 141453996) has the molecular formula C18H16N2O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is 4-hydroxy-3-[(4-hydroxy-2-oxo-1H-pyridin-3-yl)-(4-methylphenyl)methyl]-1H-pyridin-2-one.
| Compound Name | 4-hydroxy-3-[(4-hydroxy-2-oxo-1H-pyridin-3-yl)-(4-methylphenyl)methyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 141453996 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 4-hydroxy-3-[(4-hydroxy-2-oxo-1H-pyridin-3-yl)-(4-methylphenyl)methyl]-1H-pyridin-2-one |
| SMILES | Cc1ccc(C(c2c(O)cc[nH]c2=O)c2c(O)cc[nH]c2=O)cc1 |
| InChI | InChI=1S/C18H16N2O4/c1-10-2-4-11(5-3-10)14(15-12(21)6-8-19-17(15)23)16-13(22)7-9-20-18(16)24/h2-9,14H,1H3,(H2,19,21,23)(H2,20,22,24) |
| InChIKey | QSDRZOATFPHARZ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 106.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |