C17H21NO2 — CID 107711112
2-[1-[[(1S)-1-(4-methylphenyl)ethyl]amino]ethyl]benzene-1,3-diol (PubChem CID 107711112) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 2-[1-[[(1S)-1-(4-methylphenyl)ethyl]amino]ethyl]benzene-1,3-diol.
| Compound Name | 2-[1-[[(1S)-1-(4-methylphenyl)ethyl]amino]ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 107711112 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 2-[1-[[(1S)-1-(4-methylphenyl)ethyl]amino]ethyl]benzene-1,3-diol |
| SMILES | Cc1ccc([C@H](C)NC(C)c2c(O)cccc2O)cc1 |
| InChI | InChI=1S/C17H21NO2/c1-11-7-9-14(10-8-11)12(2)18-13(3)17-15(19)5-4-6-16(17)20/h4-10,12-13,18-20H,1-3H3/t12-,13?/m0/s1 |
| InChIKey | HKTOPWBWPXJSHZ-UEWDXFNNSA-N |
| XLogP | 3.82 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|