About 3-hydroxy-1H-pyridin-2-one;iridium
3-hydroxy-1H-pyridin-2-one;iridium (PubChem CID 175012048) has the molecular formula C5H5IrNO2
and a molecular weight of 303.32 g/mol. Its IUPAC name is 3-hydroxy-1H-pyridin-2-one;iridium.
Molecular Properties
| Compound Name | 3-hydroxy-1H-pyridin-2-one;iridium |
| PubChem CID | 175012048 |
| Molecular Formula | C5H5IrNO2 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | 3-hydroxy-1H-pyridin-2-one;iridium |
| SMILES | O=c1[nH]cccc1O.[Ir] |
| InChI | InChI=1S/C5H5NO2.Ir/c7-4-2-1-3-6-5(4)8;/h1-3,7H,(H,6,8); |
| InChIKey | PKXYVUQVJZLBBP-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-hydroxy-1H-pyridin-2-one;iridium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-1H-pyridin-2-one;iridium?
The IUPAC name of 3-hydroxy-1H-pyridin-2-one;iridium (CID 175012048) is 3-hydroxy-1H-pyridin-2-one;iridium.
What is the SMILES notation for 3-hydroxy-1H-pyridin-2-one;iridium?
The canonical SMILES for 3-hydroxy-1H-pyridin-2-one;iridium is O=c1[nH]cccc1O.[Ir].
What is the InChIKey of 3-hydroxy-1H-pyridin-2-one;iridium?
The InChIKey is PKXYVUQVJZLBBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO2.Ir/c7-4-2-1-3-6-5(4)8;/h1-3,7H,(H,6,8);.
What are the key properties of 3-hydroxy-1H-pyridin-2-one;iridium?
3-hydroxy-1H-pyridin-2-one;iridium has a molecular weight of 303.32 g/mol, XLogP of 0.08, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-1H-pyridin-2-one;iridium is sourced from PubChem (CID 175012048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).