C8H10N2O — CID 142498982
3-(C,N-dimethylcarbonimidoyl)-1H-pyridin-2-one (PubChem CID 142498982) has the molecular formula C8H10N2O and a molecular weight of 150.18 g/mol. Its IUPAC name is 3-(C,N-dimethylcarbonimidoyl)-1H-pyridin-2-one.
| Compound Name | 3-(C,N-dimethylcarbonimidoyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 142498982 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 3-(C,N-dimethylcarbonimidoyl)-1H-pyridin-2-one |
| SMILES | C/N=C(\C)c1ccc[nH]c1=O |
| InChI | InChI=1S/C8H10N2O/c1-6(9-2)7-4-3-5-10-8(7)11/h3-5H,1-2H3,(H,10,11)/b9-6+ |
| InChIKey | HUZFEZDFXRPAMV-RMKNXTFCSA-N |
| XLogP | 0.81 |
| TPSA | 45.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|